C27H26N2O4 — CID 123243241
[1-hydroxy-1-[4-[2-[1-(4-propan-2-yloxyphenyl)benzimidazol-5-yl]ethenyl]phenyl]ethyl] formate (PubChem CID 123243241) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is [1-hydroxy-1-[4-[2-[1-(4-propan-2-yloxyphenyl)benzimidazol-5-yl]ethenyl]phenyl]ethyl] formate.
| Compound Name | [1-hydroxy-1-[4-[2-[1-(4-propan-2-yloxyphenyl)benzimidazol-5-yl]ethenyl]phenyl]ethyl] formate |
|---|---|
| PubChem CID | 123243241 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | [1-hydroxy-1-[4-[2-[1-(4-propan-2-yloxyphenyl)benzimidazol-5-yl]ethenyl]phenyl]ethyl] formate |
| SMILES | CC(C)Oc1ccc(-n2cnc3cc(C=Cc4ccc(C(C)(O)OC=O)cc4)ccc32)cc1 |
| InChI | InChI=1S/C27H26N2O4/c1-19(2)33-24-13-11-23(12-14-24)29-17-28-25-16-21(8-15-26(25)29)5-4-20-6-9-22(10-7-20)27(3,31)32-18-30/h4-19,31H,1-3H3 |
| InChIKey | OOJIMFGWEGOUDV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|