About [2-(1,3-benzothiazol-2-yl)phenyl] 2,2-dimethylbutanoate;1-butan-2-yl-4-chlorobenzene
[2-(1,3-benzothiazol-2-yl)phenyl] 2,2-dimethylbutanoate;1-butan-2-yl-4-chlorobenzene (PubChem CID 123243427) has the molecular formula C29H32ClNO2S
and a molecular weight of 494.10 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)phenyl] 2,2-dimethylbutanoate;1-butan-2-yl-4-chlorobenzene.
Molecular Properties
| Compound Name | [2-(1,3-benzothiazol-2-yl)phenyl] 2,2-dimethylbutanoate;1-butan-2-yl-4-chlorobenzene |
| PubChem CID | 123243427 |
| Molecular Formula | C29H32ClNO2S |
| Molecular Weight | 494.10 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)phenyl] 2,2-dimethylbutanoate;1-butan-2-yl-4-chlorobenzene |
| SMILES | CCC(C)(C)C(=O)Oc1ccccc1-c1nc2ccccc2s1.CCC(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H19NO2S.C10H13Cl/c1-4-19(2,3)18(21)22-15-11-7-5-9-13(15)17-20-14-10-6-8-12-16(14)23-17;1-3-8(2)9-4-6-10(11)7-5-9/h5-12H,4H2,1-3H3;4-8H,3H2,1-2H3 |
| InChIKey | HYSSJZDZQOXATE-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.10 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,3-benzothiazol-2-yl)phenyl] 2,2-dimethylbutanoate;1-butan-2-yl-4-chlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-benzothiazol-2-yl)phenyl] 2,2-dimethylbutanoate;1-butan-2-yl-4-chlorobenzene?
The IUPAC name of [2-(1,3-benzothiazol-2-yl)phenyl] 2,2-dimethylbutanoate;1-butan-2-yl-4-chlorobenzene (CID 123243427) is [2-(1,3-benzothiazol-2-yl)phenyl] 2,2-dimethylbutanoate;1-butan-2-yl-4-chlorobenzene.
What is the SMILES notation for [2-(1,3-benzothiazol-2-yl)phenyl] 2,2-dimethylbutanoate;1-butan-2-yl-4-chlorobenzene?
The canonical SMILES for [2-(1,3-benzothiazol-2-yl)phenyl] 2,2-dimethylbutanoate;1-butan-2-yl-4-chlorobenzene is CCC(C)(C)C(=O)Oc1ccccc1-c1nc2ccccc2s1.CCC(C)c1ccc(Cl)cc1.
What is the InChIKey of [2-(1,3-benzothiazol-2-yl)phenyl] 2,2-dimethylbutanoate;1-butan-2-yl-4-chlorobenzene?
The InChIKey is HYSSJZDZQOXATE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO2S.C10H13Cl/c1-4-19(2,3)18(21)22-15-11-7-5-9-13(15)17-20-14-10-6-8-12-16(14)23-17;1-3-8(2)9-4-6-10(11)7-5-9/h5-12H,4H2,1-3H3;4-8H,3H2,1-2H3.
What are the key properties of [2-(1,3-benzothiazol-2-yl)phenyl] 2,2-dimethylbutanoate;1-butan-2-yl-4-chlorobenzene?
[2-(1,3-benzothiazol-2-yl)phenyl] 2,2-dimethylbutanoate;1-butan-2-yl-4-chlorobenzene has a molecular weight of 494.10 g/mol, XLogP of 9.16, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-benzothiazol-2-yl)phenyl] 2,2-dimethylbutanoate;1-butan-2-yl-4-chlorobenzene is sourced from PubChem (CID 123243427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).