C24H35F3O6 — CID 123243457
1,1,1-trifluoropropan-2-yl 6-oxo-3-(2,4,4-trimethyl-2-propan-2-ylpentanoyl)oxy-5-oxatricyclo[5.2.1.04,8]decane-7-carboxylate (PubChem CID 123243457) has the molecular formula C24H35F3O6 and a molecular weight of 476.53 g/mol. Its IUPAC name is 1,1,1-trifluoropropan-2-yl 6-oxo-3-(2,4,4-trimethyl-2-propan-2-ylpentanoyl)oxy-5-oxatricyclo[5.2.1.04,8]decane-7-carboxylate.
| Compound Name | 1,1,1-trifluoropropan-2-yl 6-oxo-3-(2,4,4-trimethyl-2-propan-2-ylpentanoyl)oxy-5-oxatricyclo[5.2.1.04,8]decane-7-carboxylate |
|---|---|
| PubChem CID | 123243457 |
| Molecular Formula | C24H35F3O6 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 1,1,1-trifluoropropan-2-yl 6-oxo-3-(2,4,4-trimethyl-2-propan-2-ylpentanoyl)oxy-5-oxatricyclo[5.2.1.04,8]decane-7-carboxylate |
| SMILES | CC(OC(=O)C12CC3CC(OC(=O)C(C)(CC(C)(C)C)C(C)C)C(OC1=O)C2C3)C(F)(F)F |
| InChI | InChI=1S/C24H35F3O6/c1-12(2)22(7,11-21(4,5)6)18(28)32-16-9-14-8-15-17(16)33-20(30)23(15,10-14)19(29)31-13(3)24(25,26)27/h12-17H,8-11H2,1-7H3 |
| InChIKey | BGWMOZDSQTXTLO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|