C12H20FN — CID 123243497
9,9-diethyl-4-fluoro-1,2,7,8-tetrahydroazonine (PubChem CID 123243497) has the molecular formula C12H20FN and a molecular weight of 197.30 g/mol. Its IUPAC name is 9,9-diethyl-4-fluoro-1,2,7,8-tetrahydroazonine.
| Compound Name | 9,9-diethyl-4-fluoro-1,2,7,8-tetrahydroazonine |
|---|---|
| PubChem CID | 123243497 |
| Molecular Formula | C12H20FN |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | 9,9-diethyl-4-fluoro-1,2,7,8-tetrahydroazonine |
| SMILES | CCC1(CC)CCC=CC(F)=CCN1 |
| InChI | InChI=1S/C12H20FN/c1-3-12(4-2)9-6-5-7-11(13)8-10-14-12/h5,7-8,14H,3-4,6,9-10H2,1-2H3 |
| InChIKey | ICDJCXOUGZTFNZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |