C15H14ClN5O2 — CID 123243529
[amino-[6-[3-chloro-4-(cyclopropylamino)phenyl]pyrimidin-4-yl]methylidene]carbamic acid (PubChem CID 123243529) has the molecular formula C15H14ClN5O2 and a molecular weight of 331.76 g/mol. Its IUPAC name is [amino-[6-[3-chloro-4-(cyclopropylamino)phenyl]pyrimidin-4-yl]methylidene]carbamic acid.
| Compound Name | [amino-[6-[3-chloro-4-(cyclopropylamino)phenyl]pyrimidin-4-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 123243529 |
| Molecular Formula | C15H14ClN5O2 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | [amino-[6-[3-chloro-4-(cyclopropylamino)phenyl]pyrimidin-4-yl]methylidene]carbamic acid |
| SMILES | NC(=NC(=O)O)c1cc(-c2ccc(NC3CC3)c(Cl)c2)ncn1 |
| InChI | InChI=1S/C15H14ClN5O2/c16-10-5-8(1-4-11(10)20-9-2-3-9)12-6-13(19-7-18-12)14(17)21-15(22)23/h1,4-7,9,20H,2-3H2,(H2,17,21)(H,22,23) |
| InChIKey | CJIAXMJAGBCCJR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 113.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|