About silyl 2-oxobutanoate
silyl 2-oxobutanoate (PubChem CID 123243658) has the molecular formula C4H8O3Si
and a molecular weight of 132.19 g/mol. Its IUPAC name is silyl 2-oxobutanoate.
Molecular Properties
| Compound Name | silyl 2-oxobutanoate |
| PubChem CID | 123243658 |
| Molecular Formula | C4H8O3Si |
| Molecular Weight | 132.19 g/mol |
| Exact Mass | 132.02 |
| IUPAC Name | silyl 2-oxobutanoate |
| SMILES | CCC(=O)C(=O)O[SiH3] |
| InChI | InChI=1S/C4H8O3Si/c1-2-3(5)4(6)7-8/h2H2,1,8H3 |
| InChIKey | MURQDHPLHNQYIR-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.19 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze silyl 2-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silyl 2-oxobutanoate?
The IUPAC name of silyl 2-oxobutanoate (CID 123243658) is silyl 2-oxobutanoate.
What is the SMILES notation for silyl 2-oxobutanoate?
The canonical SMILES for silyl 2-oxobutanoate is CCC(=O)C(=O)O[SiH3].
What is the InChIKey of silyl 2-oxobutanoate?
The InChIKey is MURQDHPLHNQYIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3Si/c1-2-3(5)4(6)7-8/h2H2,1,8H3.
What are the key properties of silyl 2-oxobutanoate?
silyl 2-oxobutanoate has a molecular weight of 132.19 g/mol, XLogP of -1.21, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for silyl 2-oxobutanoate is sourced from PubChem (CID 123243658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).