C17H15F3N6O — CID 123244142
4-[[2-(methylamino)-1-(2,4,5-trifluorophenyl)ethyl]amino]pyrido[3,2-d]pyrimidine-8-carboxamide (PubChem CID 123244142) has the molecular formula C17H15F3N6O and a molecular weight of 376.34 g/mol. Its IUPAC name is 4-[[2-(methylamino)-1-(2,4,5-trifluorophenyl)ethyl]amino]pyrido[3,2-d]pyrimidine-8-carboxamide.
| Compound Name | 4-[[2-(methylamino)-1-(2,4,5-trifluorophenyl)ethyl]amino]pyrido[3,2-d]pyrimidine-8-carboxamide |
|---|---|
| PubChem CID | 123244142 |
| Molecular Formula | C17H15F3N6O |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 4-[[2-(methylamino)-1-(2,4,5-trifluorophenyl)ethyl]amino]pyrido[3,2-d]pyrimidine-8-carboxamide |
| SMILES | CNCC(Nc1ncnc2c(C(N)=O)ccnc12)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H15F3N6O/c1-22-6-13(9-4-11(19)12(20)5-10(9)18)26-17-15-14(24-7-25-17)8(16(21)27)2-3-23-15/h2-5,7,13,22H,6H2,1H3,(H2,21,27)(H,24,25,26) |
| InChIKey | KNHGAKWDTPNWIC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|