C21H22BrN2+ — CID 123244310
2-(3-bromophenyl)-1-[2,6-di(propan-2-yl)cyclohexa-1,3,5-trien-1-yl]imidazole (PubChem CID 123244310) has the molecular formula C21H22BrN2+ and a molecular weight of 382.33 g/mol. Its IUPAC name is 2-(3-bromophenyl)-1-[2,6-di(propan-2-yl)cyclohexa-1,3,5-trien-1-yl]imidazole.
| Compound Name | 2-(3-bromophenyl)-1-[2,6-di(propan-2-yl)cyclohexa-1,3,5-trien-1-yl]imidazole |
|---|---|
| PubChem CID | 123244310 |
| Molecular Formula | C21H22BrN2+ |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2-(3-bromophenyl)-1-[2,6-di(propan-2-yl)cyclohexa-1,3,5-trien-1-yl]imidazole |
| SMILES | CC(C)C1=[C+]C=CC(C(C)C)=C1n1ccnc1-c1cccc(Br)c1 |
| InChI | InChI=1S/C21H22BrN2/c1-14(2)18-9-6-10-19(15(3)4)20(18)24-12-11-23-21(24)16-7-5-8-17(22)13-16/h5-9,11-15H,1-4H3/q+1 |
| InChIKey | LAHNVRQUYOEDAD-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|