C28H41N3O6S — CID 123244494
formic acid;4-methoxy-N,2,6-trimethyl-N-[5-oxo-7-(1-pyridin-4-ylpiperidin-4-yl)heptyl]benzenesulfonamide (PubChem CID 123244494) has the molecular formula C28H41N3O6S and a molecular weight of 547.72 g/mol. Its IUPAC name is formic acid;4-methoxy-N,2,6-trimethyl-N-[5-oxo-7-(1-pyridin-4-ylpiperidin-4-yl)heptyl]benzenesulfonamide.
| Compound Name | formic acid;4-methoxy-N,2,6-trimethyl-N-[5-oxo-7-(1-pyridin-4-ylpiperidin-4-yl)heptyl]benzenesulfonamide |
|---|---|
| PubChem CID | 123244494 |
| Molecular Formula | C28H41N3O6S |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | formic acid;4-methoxy-N,2,6-trimethyl-N-[5-oxo-7-(1-pyridin-4-ylpiperidin-4-yl)heptyl]benzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N(C)CCCCC(=O)CCC2CCN(c3ccncc3)CC2)c(C)c1.O=CO |
| InChI | InChI=1S/C27H39N3O4S.CH2O2/c1-21-19-26(34-4)20-22(2)27(21)35(32,33)29(3)16-6-5-7-25(31)9-8-23-12-17-30(18-13-23)24-10-14-28-15-11-24;2-1-3/h10-11,14-15,19-20,23H,5-9,12-13,16-18H2,1-4H3;1H,(H,2,3) |
| InChIKey | YYMXFBMKSGECMN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|