C8H7F4NO2 — CID 123244723
1-(2,4,4,4-tetrafluorobut-2-enyl)pyrrole-2,5-diol (PubChem CID 123244723) has the molecular formula C8H7F4NO2 and a molecular weight of 225.14 g/mol. Its IUPAC name is 1-(2,4,4,4-tetrafluorobut-2-enyl)pyrrole-2,5-diol.
| Compound Name | 1-(2,4,4,4-tetrafluorobut-2-enyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 123244723 |
| Molecular Formula | C8H7F4NO2 |
| Molecular Weight | 225.14 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 1-(2,4,4,4-tetrafluorobut-2-enyl)pyrrole-2,5-diol |
| SMILES | Oc1ccc(O)n1CC(F)=CC(F)(F)F |
| InChI | InChI=1S/C8H7F4NO2/c9-5(3-8(10,11)12)4-13-6(14)1-2-7(13)15/h1-3,14-15H,4H2 |
| InChIKey | IKQNKJCLLXNKES-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.14 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |