C11H16O — CID 123244802
2,4,5-trimethyl-2,3,4,5-tetrahydro-1-benzofuran (PubChem CID 123244802) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 2,4,5-trimethyl-2,3,4,5-tetrahydro-1-benzofuran.
| Compound Name | 2,4,5-trimethyl-2,3,4,5-tetrahydro-1-benzofuran |
|---|---|
| PubChem CID | 123244802 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 2,4,5-trimethyl-2,3,4,5-tetrahydro-1-benzofuran |
| SMILES | CC1CC2=C(C=CC(C)C2C)O1 |
| InChI | InChI=1S/C11H16O/c1-7-4-5-11-10(9(7)3)6-8(2)12-11/h4-5,7-9H,6H2,1-3H3 |
| InChIKey | QYOVOTDYMNFSOW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |