C37H33ClN16O — CID 123244934
N-[(6-chloro-3-pyridinyl)-[9-(1H-indazol-5-yl)-2-[4-(2-methoxyethyl)piperazin-1-yl]purin-8-yl]methyl]-9-(1H-indazol-6-yl)purin-2-amine (PubChem CID 123244934) has the molecular formula C37H33ClN16O and a molecular weight of 753.24 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)-[9-(1H-indazol-5-yl)-2-[4-(2-methoxyethyl)piperazin-1-yl]purin-8-yl]methyl]-9-(1H-indazol-6-yl)purin-2-amine.
| Compound Name | N-[(6-chloro-3-pyridinyl)-[9-(1H-indazol-5-yl)-2-[4-(2-methoxyethyl)piperazin-1-yl]purin-8-yl]methyl]-9-(1H-indazol-6-yl)purin-2-amine |
|---|---|
| PubChem CID | 123244934 |
| Molecular Formula | C37H33ClN16O |
| Molecular Weight | 753.24 g/mol |
| Exact Mass | 752.27 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)-[9-(1H-indazol-5-yl)-2-[4-(2-methoxyethyl)piperazin-1-yl]purin-8-yl]methyl]-9-(1H-indazol-6-yl)purin-2-amine |
| SMILES | COCCN1CCN(c2ncc3nc(C(Nc4ncc5ncn(-c6ccc7cn[nH]c7c6)c5n4)c4ccc(Cl)nc4)n(-c4ccc5[nH]ncc5c4)c3n2)CC1 |
| InChI | InChI=1S/C37H33ClN16O/c1-55-13-12-51-8-10-52(11-9-51)37-41-20-30-34(48-37)54(26-5-6-27-24(14-26)18-44-49-27)35(45-30)32(23-3-7-31(38)39-16-23)46-36-40-19-29-33(47-36)53(21-42-29)25-4-2-22-17-43-50-28(22)15-25/h2-7,14-21,32H,8-13H2,1H3,(H,43,50)(H,44,49)(H,40,46,47) |
| InChIKey | DLNFMTCMSFUBFC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 185.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.24 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|