C29H28F3N3O4 — CID 123245002
6-(2,6-difluorophenyl)-N-[4-(5-ethyl-4-hydroxy-7-oxo-3,4,4a,5,6,8,9,9a-octahydro-2H-cyclohepta[b]pyran-2-yl)-3-pyridinyl]-5-fluoropyridine-2-carboxamide (PubChem CID 123245002) has the molecular formula C29H28F3N3O4 and a molecular weight of 539.55 g/mol. Its IUPAC name is 6-(2,6-difluorophenyl)-N-[4-(5-ethyl-4-hydroxy-7-oxo-3,4,4a,5,6,8,9,9a-octahydro-2H-cyclohepta[b]pyran-2-yl)-3-pyridinyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | 6-(2,6-difluorophenyl)-N-[4-(5-ethyl-4-hydroxy-7-oxo-3,4,4a,5,6,8,9,9a-octahydro-2H-cyclohepta[b]pyran-2-yl)-3-pyridinyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 123245002 |
| Molecular Formula | C29H28F3N3O4 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | 6-(2,6-difluorophenyl)-N-[4-(5-ethyl-4-hydroxy-7-oxo-3,4,4a,5,6,8,9,9a-octahydro-2H-cyclohepta[b]pyran-2-yl)-3-pyridinyl]-5-fluoropyridine-2-carboxamide |
| SMILES | CCC1CC(=O)CCC2OC(c3ccncc3NC(=O)c3ccc(F)c(-c4c(F)cccc4F)n3)CC(O)C12 |
| InChI | InChI=1S/C29H28F3N3O4/c1-2-15-12-16(36)6-9-24-26(15)23(37)13-25(39-24)17-10-11-33-14-22(17)35-29(38)21-8-7-20(32)28(34-21)27-18(30)4-3-5-19(27)31/h3-5,7-8,10-11,14-15,23-26,37H,2,6,9,12-13H2,1H3,(H,35,38) |
| InChIKey | OYXUHHMCHFBNOX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |