C20H23N5O2 — CID 123245063
2-amino-6-(5-amino-6-methoxy-3-pyridinyl)-3-cyclohexylquinazolin-4-one (PubChem CID 123245063) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-amino-6-(5-amino-6-methoxy-3-pyridinyl)-3-cyclohexylquinazolin-4-one.
| Compound Name | 2-amino-6-(5-amino-6-methoxy-3-pyridinyl)-3-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 123245063 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-amino-6-(5-amino-6-methoxy-3-pyridinyl)-3-cyclohexylquinazolin-4-one |
| SMILES | COc1ncc(-c2ccc3nc(N)n(C4CCCCC4)c(=O)c3c2)cc1N |
| InChI | InChI=1S/C20H23N5O2/c1-27-18-16(21)10-13(11-23-18)12-7-8-17-15(9-12)19(26)25(20(22)24-17)14-5-3-2-4-6-14/h7-11,14H,2-6,21H2,1H3,(H2,22,24) |
| InChIKey | LKJUVOZBZUDXPJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |