C21H27F2N2O11P — CID 123245400
[[4-[2-[2-[2-[2-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 123245400) has the molecular formula C21H27F2N2O11P and a molecular weight of 552.42 g/mol. Its IUPAC name is [[4-[2-[2-[2-[2-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[4-[2-[2-[2-[2-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 123245400 |
| Molecular Formula | C21H27F2N2O11P |
| Molecular Weight | 552.42 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | [[4-[2-[2-[2-[2-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | O=C(Cc1ccc(C(F)(F)P(=O)(O)O)cc1)NCCOCCOCCOCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C21H27F2N2O11P/c22-21(23,37(30,31)32)16-3-1-15(2-4-16)13-17(26)24-7-8-33-9-10-34-11-12-35-14-20(29)36-25-18(27)5-6-19(25)28/h1-6,27-28H,7-14H2,(H,24,26)(H2,30,31,32) |
| InChIKey | JKESMKHVXQYZBW-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 186.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.42 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|