C26H31N3O2 — CID 123245470
2-(2-hydroxycyclopentyl)-4,5-dimethyl-6-[[4-(3-methyliminopropanimidoyl)phenyl]methyl]-3H-isoindol-1-one (PubChem CID 123245470) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is 2-(2-hydroxycyclopentyl)-4,5-dimethyl-6-[[4-(3-methyliminopropanimidoyl)phenyl]methyl]-3H-isoindol-1-one.
| Compound Name | 2-(2-hydroxycyclopentyl)-4,5-dimethyl-6-[[4-(3-methyliminopropanimidoyl)phenyl]methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 123245470 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 2-(2-hydroxycyclopentyl)-4,5-dimethyl-6-[[4-(3-methyliminopropanimidoyl)phenyl]methyl]-3H-isoindol-1-one |
| SMILES | [H]/N=C(\C/C=N/C)c1ccc(Cc2cc3c(c(C)c2C)CN(C2CCCC2O)C3=O)cc1 |
| InChI | InChI=1S/C26H31N3O2/c1-16-17(2)22-15-29(24-5-4-6-25(24)30)26(31)21(22)14-20(16)13-18-7-9-19(10-8-18)23(27)11-12-28-3/h7-10,12,14,24-25,27,30H,4-6,11,13,15H2,1-3H3/b27-23+,28-12+ |
| InChIKey | ZPKCOKNOOWSJGC-XNDVVVJGSA-N |
| XLogP | 4.22 |
| TPSA | 76.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|