C17H21F3O2 — CID 123246166
6-methyl-3-(5-methylhepta-2,4,6-trien-2-yloxy)-5-(trifluoromethoxy)hepta-1,3,5-triene (PubChem CID 123246166) has the molecular formula C17H21F3O2 and a molecular weight of 314.35 g/mol. Its IUPAC name is 6-methyl-3-(5-methylhepta-2,4,6-trien-2-yloxy)-5-(trifluoromethoxy)hepta-1,3,5-triene.
| Compound Name | 6-methyl-3-(5-methylhepta-2,4,6-trien-2-yloxy)-5-(trifluoromethoxy)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 123246166 |
| Molecular Formula | C17H21F3O2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 6-methyl-3-(5-methylhepta-2,4,6-trien-2-yloxy)-5-(trifluoromethoxy)hepta-1,3,5-triene |
| SMILES | C=CC(C)=CC=C(C)OC(C=C)=CC(OC(F)(F)F)=C(C)C |
| InChI | InChI=1S/C17H21F3O2/c1-7-13(5)9-10-14(6)21-15(8-2)11-16(12(3)4)22-17(18,19)20/h7-11H,1-2H2,3-6H3 |
| InChIKey | WSSIDZVTHJCQRT-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|