C6H9N3O12 — CID 123247106
(2S,3R,4S,5R,6S)-6-[hydroxy(nitro)methyl]-3,4-dinitrooxane-2,3,4,5-tetrol (PubChem CID 123247106) has the molecular formula C6H9N3O12 and a molecular weight of 315.15 g/mol. Its IUPAC name is (2S,3R,4S,5R,6S)-6-[hydroxy(nitro)methyl]-3,4-dinitrooxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5R,6S)-6-[hydroxy(nitro)methyl]-3,4-dinitrooxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 123247106 |
| Molecular Formula | C6H9N3O12 |
| Molecular Weight | 315.15 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | (2S,3R,4S,5R,6S)-6-[hydroxy(nitro)methyl]-3,4-dinitrooxane-2,3,4,5-tetrol |
| SMILES | O=[N+]([O-])C(O)[C@H]1O[C@H](O)[C@@](O)([N+](=O)[O-])[C@](O)([N+](=O)[O-])[C@@H]1O |
| InChI | InChI=1S/C6H9N3O12/c10-2-1(3(11)7(15)16)21-4(12)6(14,9(19)20)5(2,13)8(17)18/h1-4,10-14H/t1-,2+,3?,4-,5-,6-/m0/s1 |
| InChIKey | XQDJMCOLKVPFLO-ZYQOXDCJSA-N |
| XLogP | -4.41 |
| TPSA | 239.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.15 |
| LogP ≤ 5 | -4.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|