C19H24ClN3O4 — CID 123247499
tert-butyl 4-(3-chloro-7-methoxyquinoxalin-2-yl)oxy-3-methylpyrrolidine-2-carboxylate (PubChem CID 123247499) has the molecular formula C19H24ClN3O4 and a molecular weight of 393.87 g/mol. Its IUPAC name is tert-butyl 4-(3-chloro-7-methoxyquinoxalin-2-yl)oxy-3-methylpyrrolidine-2-carboxylate.
| Compound Name | tert-butyl 4-(3-chloro-7-methoxyquinoxalin-2-yl)oxy-3-methylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 123247499 |
| Molecular Formula | C19H24ClN3O4 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | tert-butyl 4-(3-chloro-7-methoxyquinoxalin-2-yl)oxy-3-methylpyrrolidine-2-carboxylate |
| SMILES | COc1ccc2nc(Cl)c(OC3CNC(C(=O)OC(C)(C)C)C3C)nc2c1 |
| InChI | InChI=1S/C19H24ClN3O4/c1-10-14(9-21-15(10)18(24)27-19(2,3)4)26-17-16(20)22-12-7-6-11(25-5)8-13(12)23-17/h6-8,10,14-15,21H,9H2,1-5H3 |
| InChIKey | XACAQUPEWUQUOC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |