C23H32F2N3O+ — CID 123247620
N-(2,2-difluorobutyl)-9-ethyl-2-(piperidin-4-ylmethyl)-3,4-dihydro-2-benzazepine-8-carboxamide (PubChem CID 123247620) has the molecular formula C23H32F2N3O+ and a molecular weight of 404.53 g/mol. Its IUPAC name is N-(2,2-difluorobutyl)-9-ethyl-2-(piperidin-4-ylmethyl)-3,4-dihydro-2-benzazepine-8-carboxamide.
| Compound Name | N-(2,2-difluorobutyl)-9-ethyl-2-(piperidin-4-ylmethyl)-3,4-dihydro-2-benzazepine-8-carboxamide |
|---|---|
| PubChem CID | 123247620 |
| Molecular Formula | C23H32F2N3O+ |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | N-(2,2-difluorobutyl)-9-ethyl-2-(piperidin-4-ylmethyl)-3,4-dihydro-2-benzazepine-8-carboxamide |
| SMILES | C[CH+]c1c(C(=O)NCC(F)(F)CC)ccc2c1=CN(CC1CCNCC1)CCC=2 |
| InChI | InChI=1S/C23H31F2N3O/c1-3-19-20(22(29)27-16-23(24,25)4-2)8-7-18-6-5-13-28(15-21(18)19)14-17-9-11-26-12-10-17/h3,6-8,15,17,26H,4-5,9-14,16H2,1-2H3/p+1 |
| InChIKey | AMKSGDOLHRSIQM-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|