C33H47N9O3 — CID 123247898
[amino-[6-(1-cyclobutylethylamino)-8-[4-(2,2-dimethylpropanoyl)-2-ethenylpiperazin-1-yl]-7-[(4-ethynylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid (PubChem CID 123247898) has the molecular formula C33H47N9O3 and a molecular weight of 617.80 g/mol. Its IUPAC name is [amino-[6-(1-cyclobutylethylamino)-8-[4-(2,2-dimethylpropanoyl)-2-ethenylpiperazin-1-yl]-7-[(4-ethynylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid.
| Compound Name | [amino-[6-(1-cyclobutylethylamino)-8-[4-(2,2-dimethylpropanoyl)-2-ethenylpiperazin-1-yl]-7-[(4-ethynylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 123247898 |
| Molecular Formula | C33H47N9O3 |
| Molecular Weight | 617.80 g/mol |
| Exact Mass | 617.38 |
| IUPAC Name | [amino-[6-(1-cyclobutylethylamino)-8-[4-(2,2-dimethylpropanoyl)-2-ethenylpiperazin-1-yl]-7-[(4-ethynylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid |
| SMILES | C#CC1CCC(Cn2c(N3CCN(C(=O)C(C)(C)C)CC3C=C)nc3nc(C(N)=NC(=O)O)nc(NC(C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C33H47N9O3/c1-7-21-12-14-22(15-13-21)18-42-25-27(35-20(3)23-10-9-11-23)37-29(26(34)36-32(44)45)38-28(25)39-31(42)41-17-16-40(19-24(41)8-2)30(43)33(4,5)6/h1,8,20-24H,2,9-19H2,3-6H3,(H2,34,36)(H,44,45)(H,35,37,38) |
| InChIKey | QKDUXUOJMCKCSH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.80 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|