C21H21ClFN7O2 — CID 123248027
2-[4-[3-chloro-6-(tetrazol-1-yl)cyclohexa-1,3-dien-1-yl]-6-oxo-2,3-dihydropyridin-1-yl]-3-(4-fluorophenyl)propanehydrazide (PubChem CID 123248027) has the molecular formula C21H21ClFN7O2 and a molecular weight of 457.90 g/mol. Its IUPAC name is 2-[4-[3-chloro-6-(tetrazol-1-yl)cyclohexa-1,3-dien-1-yl]-6-oxo-2,3-dihydropyridin-1-yl]-3-(4-fluorophenyl)propanehydrazide.
| Compound Name | 2-[4-[3-chloro-6-(tetrazol-1-yl)cyclohexa-1,3-dien-1-yl]-6-oxo-2,3-dihydropyridin-1-yl]-3-(4-fluorophenyl)propanehydrazide |
|---|---|
| PubChem CID | 123248027 |
| Molecular Formula | C21H21ClFN7O2 |
| Molecular Weight | 457.90 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 2-[4-[3-chloro-6-(tetrazol-1-yl)cyclohexa-1,3-dien-1-yl]-6-oxo-2,3-dihydropyridin-1-yl]-3-(4-fluorophenyl)propanehydrazide |
| SMILES | NNC(=O)C(Cc1ccc(F)cc1)N1CCC(C2=CC(Cl)=CCC2n2cnnn2)=CC1=O |
| InChI | InChI=1S/C21H21ClFN7O2/c22-15-3-6-18(30-12-25-27-28-30)17(11-15)14-7-8-29(20(31)10-14)19(21(32)26-24)9-13-1-4-16(23)5-2-13/h1-5,10-12,18-19H,6-9,24H2,(H,26,32) |
| InChIKey | HOFUJZLXUGYACR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 119.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.90 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|