C22H27FN2 — CID 123248104
2-ethenylidene-3-fluoro-10-imino-N,7-dimethyl-8-(2-methyl-3-methylidenecyclohexa-1,5-dien-1-yl)deca-3,5,8-trien-1-amine (PubChem CID 123248104) has the molecular formula C22H27FN2 and a molecular weight of 338.47 g/mol. Its IUPAC name is 2-ethenylidene-3-fluoro-10-imino-N,7-dimethyl-8-(2-methyl-3-methylidenecyclohexa-1,5-dien-1-yl)deca-3,5,8-trien-1-amine.
| Compound Name | 2-ethenylidene-3-fluoro-10-imino-N,7-dimethyl-8-(2-methyl-3-methylidenecyclohexa-1,5-dien-1-yl)deca-3,5,8-trien-1-amine |
|---|---|
| PubChem CID | 123248104 |
| Molecular Formula | C22H27FN2 |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 2-ethenylidene-3-fluoro-10-imino-N,7-dimethyl-8-(2-methyl-3-methylidenecyclohexa-1,5-dien-1-yl)deca-3,5,8-trien-1-amine |
| SMILES | [H]/N=C/C=C(C1=C(C)C(=C)CC=C1)C(C)C=CC=C(F)C(=C=C)CNC |
| InChI | InChI=1S/C22H27FN2/c1-6-19(15-25-5)22(23)12-8-10-17(3)20(13-14-24)21-11-7-9-16(2)18(21)4/h7-8,10-14,17,24-25H,1-2,9,15H2,3-5H3/b10-8?,20-13?,22-12?,24-14+ |
| InChIKey | RXFNPZQPBYJWSM-DWINLIGVSA-N |
| XLogP | 5.37 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|