C24H50N+ — CID 123248202
(4,4-diethyl-2,5,5,6-tetramethylhept-6-en-2-yl)-(4,4-dimethylpentyl)-dimethylazanium (PubChem CID 123248202) has the molecular formula C24H50N+ and a molecular weight of 352.67 g/mol. Its IUPAC name is (4,4-diethyl-2,5,5,6-tetramethylhept-6-en-2-yl)-(4,4-dimethylpentyl)-dimethylazanium.
| Compound Name | (4,4-diethyl-2,5,5,6-tetramethylhept-6-en-2-yl)-(4,4-dimethylpentyl)-dimethylazanium |
|---|---|
| PubChem CID | 123248202 |
| Molecular Formula | C24H50N+ |
| Molecular Weight | 352.67 g/mol |
| Exact Mass | 352.39 |
| IUPAC Name | (4,4-diethyl-2,5,5,6-tetramethylhept-6-en-2-yl)-(4,4-dimethylpentyl)-dimethylazanium |
| SMILES | C=C(C)C(C)(C)C(CC)(CC)CC(C)(C)[N+](C)(C)CCCC(C)(C)C |
| InChI | InChI=1S/C24H50N/c1-14-24(15-2,23(10,11)20(3)4)19-22(8,9)25(12,13)18-16-17-21(5,6)7/h3,14-19H2,1-2,4-13H3/q+1 |
| InChIKey | CLOWGYMAOLKORO-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.67 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|