C24H22FN5OS — CID 123248626
[5-(4-fluorophenyl)-2-methyl-1,3-thiazol-4-yl]-[2-(6-methoxy-1H-benzimidazol-2-yl)-4-methylidenepyrrolidin-1-yl]methanimine (PubChem CID 123248626) has the molecular formula C24H22FN5OS and a molecular weight of 447.54 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-2-methyl-1,3-thiazol-4-yl]-[2-(6-methoxy-1H-benzimidazol-2-yl)-4-methylidenepyrrolidin-1-yl]methanimine.
| Compound Name | [5-(4-fluorophenyl)-2-methyl-1,3-thiazol-4-yl]-[2-(6-methoxy-1H-benzimidazol-2-yl)-4-methylidenepyrrolidin-1-yl]methanimine |
|---|---|
| PubChem CID | 123248626 |
| Molecular Formula | C24H22FN5OS |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | [5-(4-fluorophenyl)-2-methyl-1,3-thiazol-4-yl]-[2-(6-methoxy-1H-benzimidazol-2-yl)-4-methylidenepyrrolidin-1-yl]methanimine |
| SMILES | [H]/N=C(\c1nc(C)sc1-c1ccc(F)cc1)N1CC(=C)CC1c1nc2ccc(OC)cc2[nH]1 |
| InChI | InChI=1S/C24H22FN5OS/c1-13-10-20(24-28-18-9-8-17(31-3)11-19(18)29-24)30(12-13)23(26)21-22(32-14(2)27-21)15-4-6-16(25)7-5-15/h4-9,11,20,26H,1,10,12H2,2-3H3,(H,28,29)/b26-23+ |
| InChIKey | DXLKEMGERRTYJJ-WNAAXNPUSA-N |
| XLogP | 5.47 |
| TPSA | 77.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|