About 2-methylhexan-2-yl 9-bromo-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate
2-methylhexan-2-yl 9-bromo-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate (PubChem CID 123248882) has the molecular formula C17H24BrNO3
and a molecular weight of 370.29 g/mol. Its IUPAC name is 2-methylhexan-2-yl 9-bromo-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate.
Molecular Properties
| Compound Name | 2-methylhexan-2-yl 9-bromo-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate |
| PubChem CID | 123248882 |
| Molecular Formula | C17H24BrNO3 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 2-methylhexan-2-yl 9-bromo-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate |
| SMILES | CCCCC(C)(C)OC(=O)N1CCCOc2c(Br)cccc21 |
| InChI | InChI=1S/C17H24BrNO3/c1-4-5-10-17(2,3)22-16(20)19-11-7-12-21-15-13(18)8-6-9-14(15)19/h6,8-9H,4-5,7,10-12H2,1-3H3 |
| InChIKey | GMNILTDXURNBSU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylhexan-2-yl 9-bromo-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexan-2-yl 9-bromo-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate?
The IUPAC name of 2-methylhexan-2-yl 9-bromo-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate (CID 123248882) is 2-methylhexan-2-yl 9-bromo-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate.
What is the SMILES notation for 2-methylhexan-2-yl 9-bromo-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate?
The canonical SMILES for 2-methylhexan-2-yl 9-bromo-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate is CCCCC(C)(C)OC(=O)N1CCCOc2c(Br)cccc21.
What is the InChIKey of 2-methylhexan-2-yl 9-bromo-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate?
The InChIKey is GMNILTDXURNBSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24BrNO3/c1-4-5-10-17(2,3)22-16(20)19-11-7-12-21-15-13(18)8-6-9-14(15)19/h6,8-9H,4-5,7,10-12H2,1-3H3.
What are the key properties of 2-methylhexan-2-yl 9-bromo-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate?
2-methylhexan-2-yl 9-bromo-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate has a molecular weight of 370.29 g/mol, XLogP of 5.14, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexan-2-yl 9-bromo-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate is sourced from PubChem (CID 123248882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).