C11H18N4O3S — CID 123248896
3-(1H-imidazol-5-yl)-2-[3-(1-sulfanylethylamino)propanoylamino]propanoic acid (PubChem CID 123248896) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)-2-[3-(1-sulfanylethylamino)propanoylamino]propanoic acid.
| Compound Name | 3-(1H-imidazol-5-yl)-2-[3-(1-sulfanylethylamino)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 123248896 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3-(1H-imidazol-5-yl)-2-[3-(1-sulfanylethylamino)propanoylamino]propanoic acid |
| SMILES | CC(S)NCCC(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C11H18N4O3S/c1-7(19)13-3-2-10(16)15-9(11(17)18)4-8-5-12-6-14-8/h5-7,9,13,19H,2-4H2,1H3,(H,12,14)(H,15,16)(H,17,18) |
| InChIKey | ASEJUXZOYVYMQC-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|