C33H50O3 — CID 123249616
17-(2-hydroxy-6,6-dimethyl-3-methylidenehept-4-en-2-yl)-3,4,4,9,13,14-hexamethyl-3,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-2,11-dione (PubChem CID 123249616) has the molecular formula C33H50O3 and a molecular weight of 494.76 g/mol. Its IUPAC name is 17-(2-hydroxy-6,6-dimethyl-3-methylidenehept-4-en-2-yl)-3,4,4,9,13,14-hexamethyl-3,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-2,11-dione.
| Compound Name | 17-(2-hydroxy-6,6-dimethyl-3-methylidenehept-4-en-2-yl)-3,4,4,9,13,14-hexamethyl-3,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-2,11-dione |
|---|---|
| PubChem CID | 123249616 |
| Molecular Formula | C33H50O3 |
| Molecular Weight | 494.76 g/mol |
| Exact Mass | 494.38 |
| IUPAC Name | 17-(2-hydroxy-6,6-dimethyl-3-methylidenehept-4-en-2-yl)-3,4,4,9,13,14-hexamethyl-3,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-2,11-dione |
| SMILES | C=C(C=CC(C)(C)C)C(C)(O)C1CCC2(C)C3CC=C4C(CC(=O)C(C)C4(C)C)C3(C)C(=O)CC12C |
| InChI | InChI=1S/C33H50O3/c1-20(14-16-28(3,4)5)33(11,36)26-15-17-30(8)25-13-12-22-23(18-24(34)21(2)29(22,6)7)32(25,10)27(35)19-31(26,30)9/h12,14,16,21,23,25-26,36H,1,13,15,17-19H2,2-11H3 |
| InChIKey | GELMWAXARKQPAT-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.76 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|