C18H18FNO3S — CID 123249618
4-[3-[ethyl(dihydroxy)-λ4-sulfanyl]phenyl]-7-fluoro-2-methylisoquinolin-1-one (PubChem CID 123249618) has the molecular formula C18H18FNO3S and a molecular weight of 347.41 g/mol. Its IUPAC name is 4-[3-[ethyl(dihydroxy)-λ4-sulfanyl]phenyl]-7-fluoro-2-methylisoquinolin-1-one.
| Compound Name | 4-[3-[ethyl(dihydroxy)-λ4-sulfanyl]phenyl]-7-fluoro-2-methylisoquinolin-1-one |
|---|---|
| PubChem CID | 123249618 |
| Molecular Formula | C18H18FNO3S |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 4-[3-[ethyl(dihydroxy)-λ4-sulfanyl]phenyl]-7-fluoro-2-methylisoquinolin-1-one |
| SMILES | CCS(O)(O)c1cccc(-c2cn(C)c(=O)c3cc(F)ccc23)c1 |
| InChI | InChI=1S/C18H18FNO3S/c1-3-24(22,23)14-6-4-5-12(9-14)17-11-20(2)18(21)16-10-13(19)7-8-15(16)17/h4-11,22-23H,3H2,1-2H3 |
| InChIKey | KPLSGXHPPAQVSI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |