C19H17ClN6O — CID 123249748
[7-chloro-5-[(4-pyridin-2-ylpyrimidin-2-yl)amino]-1H-indol-2-yl]-(methylamino)methanol (PubChem CID 123249748) has the molecular formula C19H17ClN6O and a molecular weight of 380.84 g/mol. Its IUPAC name is [7-chloro-5-[(4-pyridin-2-ylpyrimidin-2-yl)amino]-1H-indol-2-yl]-(methylamino)methanol.
| Compound Name | [7-chloro-5-[(4-pyridin-2-ylpyrimidin-2-yl)amino]-1H-indol-2-yl]-(methylamino)methanol |
|---|---|
| PubChem CID | 123249748 |
| Molecular Formula | C19H17ClN6O |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | [7-chloro-5-[(4-pyridin-2-ylpyrimidin-2-yl)amino]-1H-indol-2-yl]-(methylamino)methanol |
| SMILES | CNC(O)c1cc2cc(Nc3nccc(-c4ccccn4)n3)cc(Cl)c2[nH]1 |
| InChI | InChI=1S/C19H17ClN6O/c1-21-18(27)16-9-11-8-12(10-13(20)17(11)25-16)24-19-23-7-5-15(26-19)14-4-2-3-6-22-14/h2-10,18,21,25,27H,1H3,(H,23,24,26) |
| InChIKey | PWJFMBAMVYJTJZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 98.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|