About 5-butyl-4,4,5-trimethyl-2-phenyloxaborolane
5-butyl-4,4,5-trimethyl-2-phenyloxaborolane (PubChem CID 123249938) has the molecular formula C16H25BO
and a molecular weight of 244.19 g/mol. Its IUPAC name is 5-butyl-4,4,5-trimethyl-2-phenyloxaborolane.
Molecular Properties
| Compound Name | 5-butyl-4,4,5-trimethyl-2-phenyloxaborolane |
| PubChem CID | 123249938 |
| Molecular Formula | C16H25BO |
| Molecular Weight | 244.19 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 5-butyl-4,4,5-trimethyl-2-phenyloxaborolane |
| SMILES | CCCCC1(C)OB(c2ccccc2)CC1(C)C |
| InChI | InChI=1S/C16H25BO/c1-5-6-12-16(4)15(2,3)13-17(18-16)14-10-8-7-9-11-14/h7-11H,5-6,12-13H2,1-4H3 |
| InChIKey | NCYCYMGXEILHLE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.19 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-butyl-4,4,5-trimethyl-2-phenyloxaborolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-4,4,5-trimethyl-2-phenyloxaborolane?
The IUPAC name of 5-butyl-4,4,5-trimethyl-2-phenyloxaborolane (CID 123249938) is 5-butyl-4,4,5-trimethyl-2-phenyloxaborolane.
What is the SMILES notation for 5-butyl-4,4,5-trimethyl-2-phenyloxaborolane?
The canonical SMILES for 5-butyl-4,4,5-trimethyl-2-phenyloxaborolane is CCCCC1(C)OB(c2ccccc2)CC1(C)C.
What is the InChIKey of 5-butyl-4,4,5-trimethyl-2-phenyloxaborolane?
The InChIKey is NCYCYMGXEILHLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25BO/c1-5-6-12-16(4)15(2,3)13-17(18-16)14-10-8-7-9-11-14/h7-11H,5-6,12-13H2,1-4H3.
What are the key properties of 5-butyl-4,4,5-trimethyl-2-phenyloxaborolane?
5-butyl-4,4,5-trimethyl-2-phenyloxaborolane has a molecular weight of 244.19 g/mol, XLogP of 3.89, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-4,4,5-trimethyl-2-phenyloxaborolane is sourced from PubChem (CID 123249938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).