C9H21N3Si3 — CID 123249941
2,4,6-tris(ethenyl)-1,2,6-trimethyl-1,3,5,2,4,6-triazatrisilinane (PubChem CID 123249941) has the molecular formula C9H21N3Si3 and a molecular weight of 255.55 g/mol. Its IUPAC name is 2,4,6-tris(ethenyl)-1,2,6-trimethyl-1,3,5,2,4,6-triazatrisilinane.
| Compound Name | 2,4,6-tris(ethenyl)-1,2,6-trimethyl-1,3,5,2,4,6-triazatrisilinane |
|---|---|
| PubChem CID | 123249941 |
| Molecular Formula | C9H21N3Si3 |
| Molecular Weight | 255.55 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2,4,6-tris(ethenyl)-1,2,6-trimethyl-1,3,5,2,4,6-triazatrisilinane |
| SMILES | C=C[SiH]1N[Si](C)(C=C)N(C)[Si](C)(C=C)N1 |
| InChI | InChI=1S/C9H21N3Si3/c1-7-13-10-14(5,8-2)12(4)15(6,9-3)11-13/h7-11,13H,1-3H2,4-6H3 |
| InChIKey | JDHYOAFANUSXGI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.55 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|