C17H22N2O — CID 123249957
(4Z)-1-[2-(3-methylhepta-2,4,6-trienylideneamino)ethylimino]hepta-4,6-dien-3-one (PubChem CID 123249957) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is (4Z)-1-[2-(3-methylhepta-2,4,6-trienylideneamino)ethylimino]hepta-4,6-dien-3-one.
| Compound Name | (4Z)-1-[2-(3-methylhepta-2,4,6-trienylideneamino)ethylimino]hepta-4,6-dien-3-one |
|---|---|
| PubChem CID | 123249957 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (4Z)-1-[2-(3-methylhepta-2,4,6-trienylideneamino)ethylimino]hepta-4,6-dien-3-one |
| SMILES | C=CC=CC(C)=C/C=N/CC/N=C/CC(=O)/C=C\C=C |
| InChI | InChI=1S/C17H22N2O/c1-4-6-8-16(3)10-12-18-14-15-19-13-11-17(20)9-7-5-2/h4-10,12-13H,1-2,11,14-15H2,3H3/b8-6?,9-7-,16-10?,18-12+,19-13+ |
| InChIKey | VJDRAKSJEAYHES-PRGYBYSXSA-N |
| XLogP | 3.52 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|