C21H30F3N5O2 — CID 123250050
tert-butyl N-[6-(cyclopentylamino)-3-ethylimidazo[1,2-b]pyridazin-8-yl]-N-(3,3,3-trifluoropropyl)carbamate (PubChem CID 123250050) has the molecular formula C21H30F3N5O2 and a molecular weight of 441.50 g/mol. Its IUPAC name is tert-butyl N-[6-(cyclopentylamino)-3-ethylimidazo[1,2-b]pyridazin-8-yl]-N-(3,3,3-trifluoropropyl)carbamate.
| Compound Name | tert-butyl N-[6-(cyclopentylamino)-3-ethylimidazo[1,2-b]pyridazin-8-yl]-N-(3,3,3-trifluoropropyl)carbamate |
|---|---|
| PubChem CID | 123250050 |
| Molecular Formula | C21H30F3N5O2 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | tert-butyl N-[6-(cyclopentylamino)-3-ethylimidazo[1,2-b]pyridazin-8-yl]-N-(3,3,3-trifluoropropyl)carbamate |
| SMILES | CCc1cnc2c(N(CCC(F)(F)F)C(=O)OC(C)(C)C)cc(NC3CCCC3)nn12 |
| InChI | InChI=1S/C21H30F3N5O2/c1-5-15-13-25-18-16(12-17(27-29(15)18)26-14-8-6-7-9-14)28(11-10-21(22,23)24)19(30)31-20(2,3)4/h12-14H,5-11H2,1-4H3,(H,26,27) |
| InChIKey | SSTOVVWPVPUCOD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|