About (5E)-5-methyl-8-(trifluoromethoxy)nona-5,7-dien-4-imine
(5E)-5-methyl-8-(trifluoromethoxy)nona-5,7-dien-4-imine (PubChem CID 123250131) has the molecular formula C11H16F3NO
and a molecular weight of 235.25 g/mol. Its IUPAC name is (5E)-5-methyl-8-(trifluoromethoxy)nona-5,7-dien-4-imine.
Molecular Properties
| Compound Name | (5E)-5-methyl-8-(trifluoromethoxy)nona-5,7-dien-4-imine |
| PubChem CID | 123250131 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (5E)-5-methyl-8-(trifluoromethoxy)nona-5,7-dien-4-imine |
| SMILES | [H]/N=C(CCC)/C(C)=C/C=C(C)OC(F)(F)F |
| InChI | InChI=1S/C11H16F3NO/c1-4-5-10(15)8(2)6-7-9(3)16-11(12,13)14/h6-7,15H,4-5H2,1-3H3/b8-6+,9-7?,15-10+ |
| InChIKey | JCLUAHUCNCOOOR-CWBNWRJOSA-N |
| XLogP | 4.19 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-5-methyl-8-(trifluoromethoxy)nona-5,7-dien-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-methyl-8-(trifluoromethoxy)nona-5,7-dien-4-imine?
The IUPAC name of (5E)-5-methyl-8-(trifluoromethoxy)nona-5,7-dien-4-imine (CID 123250131) is (5E)-5-methyl-8-(trifluoromethoxy)nona-5,7-dien-4-imine.
What is the SMILES notation for (5E)-5-methyl-8-(trifluoromethoxy)nona-5,7-dien-4-imine?
The canonical SMILES for (5E)-5-methyl-8-(trifluoromethoxy)nona-5,7-dien-4-imine is [H]/N=C(CCC)/C(C)=C/C=C(C)OC(F)(F)F.
What is the InChIKey of (5E)-5-methyl-8-(trifluoromethoxy)nona-5,7-dien-4-imine?
The InChIKey is JCLUAHUCNCOOOR-CWBNWRJOSA-N. The full InChI is InChI=1S/C11H16F3NO/c1-4-5-10(15)8(2)6-7-9(3)16-11(12,13)14/h6-7,15H,4-5H2,1-3H3/b8-6+,9-7?,15-10+.
What are the key properties of (5E)-5-methyl-8-(trifluoromethoxy)nona-5,7-dien-4-imine?
(5E)-5-methyl-8-(trifluoromethoxy)nona-5,7-dien-4-imine has a molecular weight of 235.25 g/mol, XLogP of 4.19, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-methyl-8-(trifluoromethoxy)nona-5,7-dien-4-imine is sourced from PubChem (CID 123250131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).