C18H18F4N2O4 — CID 123250529
methyl (3R,4S)-1-(4-fluorobenzoyl)-4-prop-2-enyl-3-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-3-carboxylate (PubChem CID 123250529) has the molecular formula C18H18F4N2O4 and a molecular weight of 402.34 g/mol. Its IUPAC name is methyl (3R,4S)-1-(4-fluorobenzoyl)-4-prop-2-enyl-3-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-3-carboxylate.
| Compound Name | methyl (3R,4S)-1-(4-fluorobenzoyl)-4-prop-2-enyl-3-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 123250529 |
| Molecular Formula | C18H18F4N2O4 |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | methyl (3R,4S)-1-(4-fluorobenzoyl)-4-prop-2-enyl-3-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-3-carboxylate |
| SMILES | C=CC[C@H]1CN(C(=O)c2ccc(F)cc2)C[C@@]1(NC(=O)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C18H18F4N2O4/c1-3-4-12-9-24(14(25)11-5-7-13(19)8-6-11)10-17(12,16(27)28-2)23-15(26)18(20,21)22/h3,5-8,12H,1,4,9-10H2,2H3,(H,23,26)/t12-,17-/m0/s1 |
| InChIKey | OTSMEYKZBGVGLR-SJCJKPOMSA-N |
| XLogP | 2.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|