About 4-(7-methylcyclohepta-1,4,6-trien-1-yl)butan-2-amine
4-(7-methylcyclohepta-1,4,6-trien-1-yl)butan-2-amine (PubChem CID 123251097) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 4-(7-methylcyclohepta-1,4,6-trien-1-yl)butan-2-amine.
Molecular Properties
| Compound Name | 4-(7-methylcyclohepta-1,4,6-trien-1-yl)butan-2-amine |
| PubChem CID | 123251097 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 4-(7-methylcyclohepta-1,4,6-trien-1-yl)butan-2-amine |
| SMILES | CC1=CC=CCC=C1CCC(C)N |
| InChI | InChI=1S/C12H19N/c1-10-6-4-3-5-7-12(10)9-8-11(2)13/h3-4,6-7,11H,5,8-9,13H2,1-2H3 |
| InChIKey | GRUSLYKBNJAZIZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(7-methylcyclohepta-1,4,6-trien-1-yl)butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-methylcyclohepta-1,4,6-trien-1-yl)butan-2-amine?
The IUPAC name of 4-(7-methylcyclohepta-1,4,6-trien-1-yl)butan-2-amine (CID 123251097) is 4-(7-methylcyclohepta-1,4,6-trien-1-yl)butan-2-amine.
What is the SMILES notation for 4-(7-methylcyclohepta-1,4,6-trien-1-yl)butan-2-amine?
The canonical SMILES for 4-(7-methylcyclohepta-1,4,6-trien-1-yl)butan-2-amine is CC1=CC=CCC=C1CCC(C)N.
What is the InChIKey of 4-(7-methylcyclohepta-1,4,6-trien-1-yl)butan-2-amine?
The InChIKey is GRUSLYKBNJAZIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N/c1-10-6-4-3-5-7-12(10)9-8-11(2)13/h3-4,6-7,11H,5,8-9,13H2,1-2H3.
What are the key properties of 4-(7-methylcyclohepta-1,4,6-trien-1-yl)butan-2-amine?
4-(7-methylcyclohepta-1,4,6-trien-1-yl)butan-2-amine has a molecular weight of 177.29 g/mol, XLogP of 2.95, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-methylcyclohepta-1,4,6-trien-1-yl)butan-2-amine is sourced from PubChem (CID 123251097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).