C7H12N2 — CID 123251227
3-N-propan-2-ylidenebut-3-ene-2,3-diimine (PubChem CID 123251227) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 3-N-propan-2-ylidenebut-3-ene-2,3-diimine.
| Compound Name | 3-N-propan-2-ylidenebut-3-ene-2,3-diimine |
|---|---|
| PubChem CID | 123251227 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 3-N-propan-2-ylidenebut-3-ene-2,3-diimine |
| SMILES | [H]/N=C(\C)C(=C)N=C(C)C |
| InChI | InChI=1S/C7H12N2/c1-5(2)9-7(4)6(3)8/h8H,4H2,1-3H3/b8-6+ |
| InChIKey | QYVFHAZFOCDHMJ-SOFGYWHQSA-N |
| XLogP | 2.02 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|