C24H32FNO — CID 123251304
6-(2-fluorocyclohexa-2,4-dien-1-yl)-2-hepta-3,5-dien-3-yl-8-methoxy-4-methyl-1,2,3,7,8,8a-hexahydroquinoline (PubChem CID 123251304) has the molecular formula C24H32FNO and a molecular weight of 369.52 g/mol. Its IUPAC name is 6-(2-fluorocyclohexa-2,4-dien-1-yl)-2-hepta-3,5-dien-3-yl-8-methoxy-4-methyl-1,2,3,7,8,8a-hexahydroquinoline.
| Compound Name | 6-(2-fluorocyclohexa-2,4-dien-1-yl)-2-hepta-3,5-dien-3-yl-8-methoxy-4-methyl-1,2,3,7,8,8a-hexahydroquinoline |
|---|---|
| PubChem CID | 123251304 |
| Molecular Formula | C24H32FNO |
| Molecular Weight | 369.52 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 6-(2-fluorocyclohexa-2,4-dien-1-yl)-2-hepta-3,5-dien-3-yl-8-methoxy-4-methyl-1,2,3,7,8,8a-hexahydroquinoline |
| SMILES | CC=CC=C(CC)C1CC(C)=C2C=C(C3CC=CC=C3F)CC(OC)C2N1 |
| InChI | InChI=1S/C24H32FNO/c1-5-7-10-17(6-2)22-13-16(3)20-14-18(15-23(27-4)24(20)26-22)19-11-8-9-12-21(19)25/h5,7-10,12,14,19,22-24,26H,6,11,13,15H2,1-4H3 |
| InChIKey | DCSNTGRRLXKMCB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|