About 6-[2-[(2,3-dimethylcyclobutyl)methyl]but-2-enyl]-1,2-dimethyl-2H-pyridine
6-[2-[(2,3-dimethylcyclobutyl)methyl]but-2-enyl]-1,2-dimethyl-2H-pyridine (PubChem CID 123251562) has the molecular formula C18H29N
and a molecular weight of 259.44 g/mol. Its IUPAC name is 6-[2-[(2,3-dimethylcyclobutyl)methyl]but-2-enyl]-1,2-dimethyl-2H-pyridine.
Molecular Properties
| Compound Name | 6-[2-[(2,3-dimethylcyclobutyl)methyl]but-2-enyl]-1,2-dimethyl-2H-pyridine |
| PubChem CID | 123251562 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 6-[2-[(2,3-dimethylcyclobutyl)methyl]but-2-enyl]-1,2-dimethyl-2H-pyridine |
| SMILES | CC=C(CC1=CC=CC(C)N1C)CC1CC(C)C1C |
| InChI | InChI=1S/C18H29N/c1-6-16(11-17-10-13(2)15(17)4)12-18-9-7-8-14(3)19(18)5/h6-9,13-15,17H,10-12H2,1-5H3 |
| InChIKey | PTEQGAFYSQMJNW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-[(2,3-dimethylcyclobutyl)methyl]but-2-enyl]-1,2-dimethyl-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-[(2,3-dimethylcyclobutyl)methyl]but-2-enyl]-1,2-dimethyl-2H-pyridine?
The IUPAC name of 6-[2-[(2,3-dimethylcyclobutyl)methyl]but-2-enyl]-1,2-dimethyl-2H-pyridine (CID 123251562) is 6-[2-[(2,3-dimethylcyclobutyl)methyl]but-2-enyl]-1,2-dimethyl-2H-pyridine.
What is the SMILES notation for 6-[2-[(2,3-dimethylcyclobutyl)methyl]but-2-enyl]-1,2-dimethyl-2H-pyridine?
The canonical SMILES for 6-[2-[(2,3-dimethylcyclobutyl)methyl]but-2-enyl]-1,2-dimethyl-2H-pyridine is CC=C(CC1=CC=CC(C)N1C)CC1CC(C)C1C.
What is the InChIKey of 6-[2-[(2,3-dimethylcyclobutyl)methyl]but-2-enyl]-1,2-dimethyl-2H-pyridine?
The InChIKey is PTEQGAFYSQMJNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N/c1-6-16(11-17-10-13(2)15(17)4)12-18-9-7-8-14(3)19(18)5/h6-9,13-15,17H,10-12H2,1-5H3.
What are the key properties of 6-[2-[(2,3-dimethylcyclobutyl)methyl]but-2-enyl]-1,2-dimethyl-2H-pyridine?
6-[2-[(2,3-dimethylcyclobutyl)methyl]but-2-enyl]-1,2-dimethyl-2H-pyridine has a molecular weight of 259.44 g/mol, XLogP of 4.78, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-[(2,3-dimethylcyclobutyl)methyl]but-2-enyl]-1,2-dimethyl-2H-pyridine is sourced from PubChem (CID 123251562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).