C31H41N8OS+ — CID 123251842
6-[4-[3,6-dimethyl-2-[(4-methylpiperazin-1-yl)methyl]-5-propan-2-ylpyrimidin-3-ium-4-yl]-9-methyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]-[1,3]thiazolo[5,4-b]pyridin-2-amine (PubChem CID 123251842) has the molecular formula C31H41N8OS+ and a molecular weight of 573.79 g/mol. Its IUPAC name is 6-[4-[3,6-dimethyl-2-[(4-methylpiperazin-1-yl)methyl]-5-propan-2-ylpyrimidin-3-ium-4-yl]-9-methyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]-[1,3]thiazolo[5,4-b]pyridin-2-amine.
| Compound Name | 6-[4-[3,6-dimethyl-2-[(4-methylpiperazin-1-yl)methyl]-5-propan-2-ylpyrimidin-3-ium-4-yl]-9-methyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]-[1,3]thiazolo[5,4-b]pyridin-2-amine |
|---|---|
| PubChem CID | 123251842 |
| Molecular Formula | C31H41N8OS+ |
| Molecular Weight | 573.79 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | 6-[4-[3,6-dimethyl-2-[(4-methylpiperazin-1-yl)methyl]-5-propan-2-ylpyrimidin-3-ium-4-yl]-9-methyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]-[1,3]thiazolo[5,4-b]pyridin-2-amine |
| SMILES | Cc1cc(-c2cnc3sc(N)nc3c2)cc2c1OCCN(c1c(C(C)C)c(C)nc(CN3CCN(C)CC3)[n+]1C)C2 |
| InChI | InChI=1S/C31H41N8OS/c1-19(2)27-21(4)34-26(18-38-9-7-36(5)8-10-38)37(6)30(27)39-11-12-40-28-20(3)13-22(14-24(28)17-39)23-15-25-29(33-16-23)41-31(32)35-25/h13-16,19H,7-12,17-18H2,1-6H3,(H2,32,35)/q+1 |
| InChIKey | CXQGGLHKXUABFL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 87.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.79 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|