C7H10N2O3 — CID 123251912
1,3-dimethyl-2-oxo-4H-pyrimidine-5-carboxylic acid (PubChem CID 123251912) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is 1,3-dimethyl-2-oxo-4H-pyrimidine-5-carboxylic acid.
| Compound Name | 1,3-dimethyl-2-oxo-4H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 123251912 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 1,3-dimethyl-2-oxo-4H-pyrimidine-5-carboxylic acid |
| SMILES | CN1C=C(C(=O)O)CN(C)C1=O |
| InChI | InChI=1S/C7H10N2O3/c1-8-3-5(6(10)11)4-9(2)7(8)12/h3H,4H2,1-2H3,(H,10,11) |
| InChIKey | GBYIHMMDNUKWSK-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |