C30H57N — CID 123252126
2-ethyl-6-(11-ethyl-9-methyl-5-pentyl-4-bicyclo[7.2.0]undec-3-enyl)-N,N,2-trimethylhexan-1-amine (PubChem CID 123252126) has the molecular formula C30H57N and a molecular weight of 431.79 g/mol. Its IUPAC name is 2-ethyl-6-(11-ethyl-9-methyl-5-pentyl-4-bicyclo[7.2.0]undec-3-enyl)-N,N,2-trimethylhexan-1-amine.
| Compound Name | 2-ethyl-6-(11-ethyl-9-methyl-5-pentyl-4-bicyclo[7.2.0]undec-3-enyl)-N,N,2-trimethylhexan-1-amine |
|---|---|
| PubChem CID | 123252126 |
| Molecular Formula | C30H57N |
| Molecular Weight | 431.79 g/mol |
| Exact Mass | 431.45 |
| IUPAC Name | 2-ethyl-6-(11-ethyl-9-methyl-5-pentyl-4-bicyclo[7.2.0]undec-3-enyl)-N,N,2-trimethylhexan-1-amine |
| SMILES | CCCCCC1CCCC2(C)CC(CC)C2CC=C1CCCCC(C)(CC)CN(C)C |
| InChI | InChI=1S/C30H57N/c1-8-11-12-16-26-18-15-22-30(5)23-25(9-2)28(30)20-19-27(26)17-13-14-21-29(4,10-3)24-31(6)7/h19,25-26,28H,8-18,20-24H2,1-7H3 |
| InChIKey | GJNJXGODPJKYEO-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.79 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|