C34H42N2O6 — CID 123252154
(5,20-dihydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.6.1.01,5.06,11.014,16]icosa-2,11-dien-4-yl) 3-phenylimidazole-4-carboxylate (PubChem CID 123252154) has the molecular formula C34H42N2O6 and a molecular weight of 574.72 g/mol. Its IUPAC name is (5,20-dihydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.6.1.01,5.06,11.014,16]icosa-2,11-dien-4-yl) 3-phenylimidazole-4-carboxylate.
| Compound Name | (5,20-dihydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.6.1.01,5.06,11.014,16]icosa-2,11-dien-4-yl) 3-phenylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 123252154 |
| Molecular Formula | C34H42N2O6 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.30 |
| IUPAC Name | (5,20-dihydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.6.1.01,5.06,11.014,16]icosa-2,11-dien-4-yl) 3-phenylimidazole-4-carboxylate |
| SMILES | CC1=CC23CC(C)CC4C(C(C=C5COC(C)(C)OC5C2(O)C1OC(=O)c1cncn1-c1ccccc1)C3O)C4(C)C |
| InChI | InChI=1S/C34H42N2O6/c1-19-12-24-26(31(24,3)4)23-13-21-17-40-32(5,6)42-29(21)34(39)28(20(2)15-33(34,14-19)27(23)37)41-30(38)25-16-35-18-36(25)22-10-8-7-9-11-22/h7-11,13,15-16,18-19,23-24,26-29,37,39H,12,14,17H2,1-6H3 |
| InChIKey | DBAKGUPNGHEHCD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|