C22H18ClNO4 — CID 123253497
3-[4-[[5-[(2-chlorophenyl)methoxy]-2-pyridinyl]oxy]-3-methylphenyl]prop-2-enoic acid (PubChem CID 123253497) has the molecular formula C22H18ClNO4 and a molecular weight of 395.84 g/mol. Its IUPAC name is 3-[4-[[5-[(2-chlorophenyl)methoxy]-2-pyridinyl]oxy]-3-methylphenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[[5-[(2-chlorophenyl)methoxy]-2-pyridinyl]oxy]-3-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123253497 |
| Molecular Formula | C22H18ClNO4 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 3-[4-[[5-[(2-chlorophenyl)methoxy]-2-pyridinyl]oxy]-3-methylphenyl]prop-2-enoic acid |
| SMILES | Cc1cc(C=CC(=O)O)ccc1Oc1ccc(OCc2ccccc2Cl)cn1 |
| InChI | InChI=1S/C22H18ClNO4/c1-15-12-16(7-11-22(25)26)6-9-20(15)28-21-10-8-18(13-24-21)27-14-17-4-2-3-5-19(17)23/h2-13H,14H2,1H3,(H,25,26) |
| InChIKey | YULSGFLZRWURRT-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|