About N-(1-cyanocyclopropyl)-4,4-difluoro-2-[3-(methylamino)butyl]heptanamide
N-(1-cyanocyclopropyl)-4,4-difluoro-2-[3-(methylamino)butyl]heptanamide (PubChem CID 123253538) has the molecular formula C16H27F2N3O
and a molecular weight of 315.41 g/mol. Its IUPAC name is N-(1-cyanocyclopropyl)-4,4-difluoro-2-[3-(methylamino)butyl]heptanamide.
Molecular Properties
| Compound Name | N-(1-cyanocyclopropyl)-4,4-difluoro-2-[3-(methylamino)butyl]heptanamide |
| PubChem CID | 123253538 |
| Molecular Formula | C16H27F2N3O |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | N-(1-cyanocyclopropyl)-4,4-difluoro-2-[3-(methylamino)butyl]heptanamide |
| SMILES | CCCC(F)(F)CC(CCC(C)NC)C(=O)NC1(C#N)CC1 |
| InChI | InChI=1S/C16H27F2N3O/c1-4-7-16(17,18)10-13(6-5-12(2)20-3)14(22)21-15(11-19)8-9-15/h12-13,20H,4-10H2,1-3H3,(H,21,22) |
| InChIKey | YIOWUAUNCDKGCG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-cyanocyclopropyl)-4,4-difluoro-2-[3-(methylamino)butyl]heptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyanocyclopropyl)-4,4-difluoro-2-[3-(methylamino)butyl]heptanamide?
The IUPAC name of N-(1-cyanocyclopropyl)-4,4-difluoro-2-[3-(methylamino)butyl]heptanamide (CID 123253538) is N-(1-cyanocyclopropyl)-4,4-difluoro-2-[3-(methylamino)butyl]heptanamide.
What is the SMILES notation for N-(1-cyanocyclopropyl)-4,4-difluoro-2-[3-(methylamino)butyl]heptanamide?
The canonical SMILES for N-(1-cyanocyclopropyl)-4,4-difluoro-2-[3-(methylamino)butyl]heptanamide is CCCC(F)(F)CC(CCC(C)NC)C(=O)NC1(C#N)CC1.
What is the InChIKey of N-(1-cyanocyclopropyl)-4,4-difluoro-2-[3-(methylamino)butyl]heptanamide?
The InChIKey is YIOWUAUNCDKGCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27F2N3O/c1-4-7-16(17,18)10-13(6-5-12(2)20-3)14(22)21-15(11-19)8-9-15/h12-13,20H,4-10H2,1-3H3,(H,21,22).
What are the key properties of N-(1-cyanocyclopropyl)-4,4-difluoro-2-[3-(methylamino)butyl]heptanamide?
N-(1-cyanocyclopropyl)-4,4-difluoro-2-[3-(methylamino)butyl]heptanamide has a molecular weight of 315.41 g/mol, XLogP of 2.99, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyanocyclopropyl)-4,4-difluoro-2-[3-(methylamino)butyl]heptanamide is sourced from PubChem (CID 123253538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).