C27H35Cl3FN4O2+ — CID 123254061
[1-chloro-3-[[2-(2,6-dichloro-4-fluorophenyl)-2-oxoethyl]-(4,4-dimethylcyclohexyl)amino]-2-methanimidoyl-3-oxoprop-1-enyl]-imino-(4-methylcyclohexyl)azanium (PubChem CID 123254061) has the molecular formula C27H35Cl3FN4O2+ and a molecular weight of 572.96 g/mol. Its IUPAC name is [1-chloro-3-[[2-(2,6-dichloro-4-fluorophenyl)-2-oxoethyl]-(4,4-dimethylcyclohexyl)amino]-2-methanimidoyl-3-oxoprop-1-enyl]-imino-(4-methylcyclohexyl)azanium.
| Compound Name | [1-chloro-3-[[2-(2,6-dichloro-4-fluorophenyl)-2-oxoethyl]-(4,4-dimethylcyclohexyl)amino]-2-methanimidoyl-3-oxoprop-1-enyl]-imino-(4-methylcyclohexyl)azanium |
|---|---|
| PubChem CID | 123254061 |
| Molecular Formula | C27H35Cl3FN4O2+ |
| Molecular Weight | 572.96 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | [1-chloro-3-[[2-(2,6-dichloro-4-fluorophenyl)-2-oxoethyl]-(4,4-dimethylcyclohexyl)amino]-2-methanimidoyl-3-oxoprop-1-enyl]-imino-(4-methylcyclohexyl)azanium |
| SMILES | [H]/N=C/C(C(=O)N(CC(=O)c1c(Cl)cc(F)cc1Cl)C1CCC(C)(C)CC1)=C(Cl)/[N+](=N/[H])C1CCC(C)CC1 |
| InChI | InChI=1S/C27H35Cl3FN4O2/c1-16-4-6-19(7-5-16)35(33)25(30)20(14-32)26(37)34(18-8-10-27(2,3)11-9-18)15-23(36)24-21(28)12-17(31)13-22(24)29/h12-14,16,18-19,32-33H,4-11,15H2,1-3H3/q+1/b25-20?,32-14+,35-33+ |
| InChIKey | JLDUMGWPOYJQGO-DTBZTAKPSA-N |
| XLogP | 7.83 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.96 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|