About 2-hexyl-4-methyl-3a,4-dihydro-1H-isoindol-2-ium
2-hexyl-4-methyl-3a,4-dihydro-1H-isoindol-2-ium (PubChem CID 123254289) has the molecular formula C15H24N+
and a molecular weight of 218.36 g/mol. Its IUPAC name is 2-hexyl-4-methyl-3a,4-dihydro-1H-isoindol-2-ium.
Molecular Properties
| Compound Name | 2-hexyl-4-methyl-3a,4-dihydro-1H-isoindol-2-ium |
| PubChem CID | 123254289 |
| Molecular Formula | C15H24N+ |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | 2-hexyl-4-methyl-3a,4-dihydro-1H-isoindol-2-ium |
| SMILES | CCCCCC[N+]1=CC2C(=CC=CC2C)C1 |
| InChI | InChI=1S/C15H24N/c1-3-4-5-6-10-16-11-14-9-7-8-13(2)15(14)12-16/h7-9,12-13,15H,3-6,10-11H2,1-2H3/q+1 |
| InChIKey | PDHQYXDSHNVUJH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hexyl-4-methyl-3a,4-dihydro-1H-isoindol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexyl-4-methyl-3a,4-dihydro-1H-isoindol-2-ium?
The IUPAC name of 2-hexyl-4-methyl-3a,4-dihydro-1H-isoindol-2-ium (CID 123254289) is 2-hexyl-4-methyl-3a,4-dihydro-1H-isoindol-2-ium.
What is the SMILES notation for 2-hexyl-4-methyl-3a,4-dihydro-1H-isoindol-2-ium?
The canonical SMILES for 2-hexyl-4-methyl-3a,4-dihydro-1H-isoindol-2-ium is CCCCCC[N+]1=CC2C(=CC=CC2C)C1.
What is the InChIKey of 2-hexyl-4-methyl-3a,4-dihydro-1H-isoindol-2-ium?
The InChIKey is PDHQYXDSHNVUJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N/c1-3-4-5-6-10-16-11-14-9-7-8-13(2)15(14)12-16/h7-9,12-13,15H,3-6,10-11H2,1-2H3/q+1.
What are the key properties of 2-hexyl-4-methyl-3a,4-dihydro-1H-isoindol-2-ium?
2-hexyl-4-methyl-3a,4-dihydro-1H-isoindol-2-ium has a molecular weight of 218.36 g/mol, XLogP of 3.41, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyl-4-methyl-3a,4-dihydro-1H-isoindol-2-ium is sourced from PubChem (CID 123254289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).