C20H16 — CID 123254733
tricyclo[14.4.0.02,7]icosa-1(20),2,4,6,8,10,12,14,16,18-decaene (PubChem CID 123254733) has the molecular formula C20H16 and a molecular weight of 256.35 g/mol. Its IUPAC name is tricyclo[14.4.0.02,7]icosa-1(20),2,4,6,8,10,12,14,16,18-decaene.
| Compound Name | tricyclo[14.4.0.02,7]icosa-1(20),2,4,6,8,10,12,14,16,18-decaene |
|---|---|
| PubChem CID | 123254733 |
| Molecular Formula | C20H16 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | tricyclo[14.4.0.02,7]icosa-1(20),2,4,6,8,10,12,14,16,18-decaene |
| SMILES | C1=CC=Cc2ccccc2-c2ccccc2C=CC=C1 |
| InChI | InChI=1S/C20H16/c1-2-4-6-12-18-14-8-10-16-20(18)19-15-9-7-13-17(19)11-5-3-1/h1-16H/b2-1?,3-1?,4-2?,5-3?,6-4?,11-5?,12-6?,17-11?,18-12?,20-19- |
| InChIKey | WZFJYSAUMMCGCO-KATSHNPVSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |