About 5-(2-hydroxyethyl)-2,3-dihydro-1H-indole-2,6-diol
5-(2-hydroxyethyl)-2,3-dihydro-1H-indole-2,6-diol (PubChem CID 123254882) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-2,3-dihydro-1H-indole-2,6-diol.
Molecular Properties
| Compound Name | 5-(2-hydroxyethyl)-2,3-dihydro-1H-indole-2,6-diol |
| PubChem CID | 123254882 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 5-(2-hydroxyethyl)-2,3-dihydro-1H-indole-2,6-diol |
| SMILES | OCCc1cc2c(cc1O)NC(O)C2 |
| InChI | InChI=1S/C10H13NO3/c12-2-1-6-3-7-4-10(14)11-8(7)5-9(6)13/h3,5,10-14H,1-2,4H2 |
| InChIKey | GWWISDCGISQWLP-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-hydroxyethyl)-2,3-dihydro-1H-indole-2,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-hydroxyethyl)-2,3-dihydro-1H-indole-2,6-diol?
The IUPAC name of 5-(2-hydroxyethyl)-2,3-dihydro-1H-indole-2,6-diol (CID 123254882) is 5-(2-hydroxyethyl)-2,3-dihydro-1H-indole-2,6-diol.
What is the SMILES notation for 5-(2-hydroxyethyl)-2,3-dihydro-1H-indole-2,6-diol?
The canonical SMILES for 5-(2-hydroxyethyl)-2,3-dihydro-1H-indole-2,6-diol is OCCc1cc2c(cc1O)NC(O)C2.
What is the InChIKey of 5-(2-hydroxyethyl)-2,3-dihydro-1H-indole-2,6-diol?
The InChIKey is GWWISDCGISQWLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c12-2-1-6-3-7-4-10(14)11-8(7)5-9(6)13/h3,5,10-14H,1-2,4H2.
What are the key properties of 5-(2-hydroxyethyl)-2,3-dihydro-1H-indole-2,6-diol?
5-(2-hydroxyethyl)-2,3-dihydro-1H-indole-2,6-diol has a molecular weight of 195.22 g/mol, XLogP of 0.21, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-hydroxyethyl)-2,3-dihydro-1H-indole-2,6-diol is sourced from PubChem (CID 123254882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).